C7H12N2OS — CID 43079498
N-(1-methoxypropan-2-yl)-1,3-thiazol-2-amine (PubChem CID 43079498) has the molecular formula C7H12N2OS and a molecular weight of 172.25 g/mol. Its IUPAC name is N-(1-methoxypropan-2-yl)-1,3-thiazol-2-amine.
| Compound Name | N-(1-methoxypropan-2-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 43079498 |
| Molecular Formula | C7H12N2OS |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | N-(1-methoxypropan-2-yl)-1,3-thiazol-2-amine |
| SMILES | COCC(C)Nc1nccs1 |
| InChI | InChI=1S/C7H12N2OS/c1-6(5-10-2)9-7-8-3-4-11-7/h3-4,6H,5H2,1-2H3,(H,8,9) |
| InChIKey | MSKINGCLWONOTB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |