C6H10N2S — CID 2160964
N-propan-2-yl-1,3-thiazol-2-amine (PubChem CID 2160964) has the molecular formula C6H10N2S and a molecular weight of 142.23 g/mol. Its IUPAC name is N-propan-2-yl-1,3-thiazol-2-amine.
| Compound Name | N-propan-2-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 2160964 |
| Molecular Formula | C6H10N2S |
| Molecular Weight | 142.23 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | N-propan-2-yl-1,3-thiazol-2-amine |
| SMILES | CC(C)Nc1nccs1 |
| InChI | InChI=1S/C6H10N2S/c1-5(2)8-6-7-3-4-9-6/h3-5H,1-2H3,(H,7,8) |
| InChIKey | UTOIYHRXEBTSRG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.23 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |