C8H15N3S — CID 20786153
N'-propan-2-yl-N-(1,3-thiazol-2-yl)ethane-1,2-diamine (PubChem CID 20786153) has the molecular formula C8H15N3S and a molecular weight of 185.30 g/mol. Its IUPAC name is N'-propan-2-yl-N-(1,3-thiazol-2-yl)ethane-1,2-diamine.
| Compound Name | N'-propan-2-yl-N-(1,3-thiazol-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 20786153 |
| Molecular Formula | C8H15N3S |
| Molecular Weight | 185.30 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | N'-propan-2-yl-N-(1,3-thiazol-2-yl)ethane-1,2-diamine |
| SMILES | CC(C)NCCNc1nccs1 |
| InChI | InChI=1S/C8H15N3S/c1-7(2)9-3-4-10-8-11-5-6-12-8/h5-7,9H,3-4H2,1-2H3,(H,10,11) |
| InChIKey | SFELBHNNZXBPCX-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|