C7H10N2O2S — CID 60658875
methyl 3-(1,3-thiazol-2-ylamino)propanoate (PubChem CID 60658875) has the molecular formula C7H10N2O2S and a molecular weight of 186.24 g/mol. Its IUPAC name is methyl 3-(1,3-thiazol-2-ylamino)propanoate.
| Compound Name | methyl 3-(1,3-thiazol-2-ylamino)propanoate |
|---|---|
| PubChem CID | 60658875 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | methyl 3-(1,3-thiazol-2-ylamino)propanoate |
| SMILES | COC(=O)CCNc1nccs1 |
| InChI | InChI=1S/C7H10N2O2S/c1-11-6(10)2-3-8-7-9-4-5-12-7/h4-5H,2-3H2,1H3,(H,8,9) |
| InChIKey | GFGMXVXWJNDRON-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |