C8H14N4OS2 — CID 88761395
1-methyl-3-[3-(1,3-thiazol-2-ylamino)propylsulfanyl]urea (PubChem CID 88761395) has the molecular formula C8H14N4OS2 and a molecular weight of 246.36 g/mol. Its IUPAC name is 1-methyl-3-[3-(1,3-thiazol-2-ylamino)propylsulfanyl]urea.
| Compound Name | 1-methyl-3-[3-(1,3-thiazol-2-ylamino)propylsulfanyl]urea |
|---|---|
| PubChem CID | 88761395 |
| Molecular Formula | C8H14N4OS2 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 1-methyl-3-[3-(1,3-thiazol-2-ylamino)propylsulfanyl]urea |
| SMILES | CNC(=O)NSCCCNc1nccs1 |
| InChI | InChI=1S/C8H14N4OS2/c1-9-7(13)12-15-5-2-3-10-8-11-4-6-14-8/h4,6H,2-3,5H2,1H3,(H,10,11)(H2,9,12,13) |
| InChIKey | PCBRUEYBLZZXMP-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|