C6H9N3OS — CID 23548411
1-methyl-3-(1,3-thiazol-2-ylmethyl)urea (PubChem CID 23548411) has the molecular formula C6H9N3OS and a molecular weight of 171.23 g/mol. Its IUPAC name is 1-methyl-3-(1,3-thiazol-2-ylmethyl)urea.
| Compound Name | 1-methyl-3-(1,3-thiazol-2-ylmethyl)urea |
|---|---|
| PubChem CID | 23548411 |
| Molecular Formula | C6H9N3OS |
| Molecular Weight | 171.23 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 1-methyl-3-(1,3-thiazol-2-ylmethyl)urea |
| SMILES | CNC(=O)NCc1nccs1 |
| InChI | InChI=1S/C6H9N3OS/c1-7-6(10)9-4-5-8-2-3-11-5/h2-3H,4H2,1H3,(H2,7,9,10) |
| InChIKey | RMQDESDSPTUSBM-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.23 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |