C7H9N3O2S — CID 130634316
N-methyl-N'-(1,3-thiazol-2-ylmethyl)oxamide (PubChem CID 130634316) has the molecular formula C7H9N3O2S and a molecular weight of 199.24 g/mol. Its IUPAC name is N-methyl-N'-(1,3-thiazol-2-ylmethyl)oxamide.
| Compound Name | N-methyl-N'-(1,3-thiazol-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 130634316 |
| Molecular Formula | C7H9N3O2S |
| Molecular Weight | 199.24 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | N-methyl-N'-(1,3-thiazol-2-ylmethyl)oxamide |
| SMILES | CNC(=O)C(=O)NCc1nccs1 |
| InChI | InChI=1S/C7H9N3O2S/c1-8-6(11)7(12)10-4-5-9-2-3-13-5/h2-3H,4H2,1H3,(H,8,11)(H,10,12) |
| InChIKey | YHWLDHIVJSZZID-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.24 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|