C8H14N2OS — CID 177244063
ethane;N-(1,3-thiazol-2-ylmethyl)acetamide (PubChem CID 177244063) has the molecular formula C8H14N2OS and a molecular weight of 186.28 g/mol. Its IUPAC name is ethane;N-(1,3-thiazol-2-ylmethyl)acetamide.
| Compound Name | ethane;N-(1,3-thiazol-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 177244063 |
| Molecular Formula | C8H14N2OS |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | ethane;N-(1,3-thiazol-2-ylmethyl)acetamide |
| SMILES | CC.CC(=O)NCc1nccs1 |
| InChI | InChI=1S/C6H8N2OS.C2H6/c1-5(9)8-4-6-7-2-3-10-6;1-2/h2-3H,4H2,1H3,(H,8,9);1-2H3 |
| InChIKey | FXTADJBIVCXJAV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |