C7H11N3OS — CID 61284856
3-amino-N-(1,3-thiazol-2-ylmethyl)propanamide (PubChem CID 61284856) has the molecular formula C7H11N3OS and a molecular weight of 185.25 g/mol. Its IUPAC name is 3-amino-N-(1,3-thiazol-2-ylmethyl)propanamide.
| Compound Name | 3-amino-N-(1,3-thiazol-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 61284856 |
| Molecular Formula | C7H11N3OS |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 3-amino-N-(1,3-thiazol-2-ylmethyl)propanamide |
| SMILES | NCCC(=O)NCc1nccs1 |
| InChI | InChI=1S/C7H11N3OS/c8-2-1-6(11)10-5-7-9-3-4-12-7/h3-4H,1-2,5,8H2,(H,10,11) |
| InChIKey | KBETZXVDAIQVIV-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |