C8H13N3OS — CID 79023405
(2S)-2-amino-N-(1,3-thiazol-2-ylmethyl)butanamide (PubChem CID 79023405) has the molecular formula C8H13N3OS and a molecular weight of 199.28 g/mol. Its IUPAC name is (2S)-2-amino-N-(1,3-thiazol-2-ylmethyl)butanamide.
| Compound Name | (2S)-2-amino-N-(1,3-thiazol-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 79023405 |
| Molecular Formula | C8H13N3OS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | (2S)-2-amino-N-(1,3-thiazol-2-ylmethyl)butanamide |
| SMILES | CC[C@H](N)C(=O)NCc1nccs1 |
| InChI | InChI=1S/C8H13N3OS/c1-2-6(9)8(12)11-5-7-10-3-4-13-7/h3-4,6H,2,5,9H2,1H3,(H,11,12)/t6-/m0/s1 |
| InChIKey | JTKVAOKKGLKFGP-LURJTMIESA-N |
| XLogP | 0.50 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |