C10H17N3OS — CID 104878243
(2R)-2-amino-N-[2-(1,3-thiazol-2-yl)propan-2-yl]butanamide (PubChem CID 104878243) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is (2R)-2-amino-N-[2-(1,3-thiazol-2-yl)propan-2-yl]butanamide.
| Compound Name | (2R)-2-amino-N-[2-(1,3-thiazol-2-yl)propan-2-yl]butanamide |
|---|---|
| PubChem CID | 104878243 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | (2R)-2-amino-N-[2-(1,3-thiazol-2-yl)propan-2-yl]butanamide |
| SMILES | CC[C@@H](N)C(=O)NC(C)(C)c1nccs1 |
| InChI | InChI=1S/C10H17N3OS/c1-4-7(11)8(14)13-10(2,3)9-12-5-6-15-9/h5-7H,4,11H2,1-3H3,(H,13,14)/t7-/m1/s1 |
| InChIKey | UQQTVGNUEPJIRJ-SSDOTTSWSA-N |
| XLogP | 1.23 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |