C8H12N4O2S — CID 61284261
2-amino-N-(1,3-thiazol-2-ylmethyl)butanediamide (PubChem CID 61284261) has the molecular formula C8H12N4O2S and a molecular weight of 228.28 g/mol. Its IUPAC name is 2-amino-N-(1,3-thiazol-2-ylmethyl)butanediamide.
| Compound Name | 2-amino-N-(1,3-thiazol-2-ylmethyl)butanediamide |
|---|---|
| PubChem CID | 61284261 |
| Molecular Formula | C8H12N4O2S |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 2-amino-N-(1,3-thiazol-2-ylmethyl)butanediamide |
| SMILES | NC(=O)CC(N)C(=O)NCc1nccs1 |
| InChI | InChI=1S/C8H12N4O2S/c9-5(3-6(10)13)8(14)12-4-7-11-1-2-15-7/h1-2,5H,3-4,9H2,(H2,10,13)(H,12,14) |
| InChIKey | OCFWNFDBDZBFCV-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |