C12H14N4O2S — CID 61247861
2-amino-N-(1,3-benzothiazol-2-ylmethyl)butanediamide (PubChem CID 61247861) has the molecular formula C12H14N4O2S and a molecular weight of 278.34 g/mol. Its IUPAC name is 2-amino-N-(1,3-benzothiazol-2-ylmethyl)butanediamide.
| Compound Name | 2-amino-N-(1,3-benzothiazol-2-ylmethyl)butanediamide |
|---|---|
| PubChem CID | 61247861 |
| Molecular Formula | C12H14N4O2S |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 2-amino-N-(1,3-benzothiazol-2-ylmethyl)butanediamide |
| SMILES | NC(=O)CC(N)C(=O)NCc1nc2ccccc2s1 |
| InChI | InChI=1S/C12H14N4O2S/c13-7(5-10(14)17)12(18)15-6-11-16-8-3-1-2-4-9(8)19-11/h1-4,7H,5-6,13H2,(H2,14,17)(H,15,18) |
| InChIKey | WROHKBMCGJOVCX-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |