C10H11N3OS — CID 23548661
1-(1,3-benzothiazol-2-ylmethyl)-3-methylurea (PubChem CID 23548661) has the molecular formula C10H11N3OS and a molecular weight of 221.28 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-ylmethyl)-3-methylurea.
| Compound Name | 1-(1,3-benzothiazol-2-ylmethyl)-3-methylurea |
|---|---|
| PubChem CID | 23548661 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 1-(1,3-benzothiazol-2-ylmethyl)-3-methylurea |
| SMILES | CNC(=O)NCc1nc2ccccc2s1 |
| InChI | InChI=1S/C10H11N3OS/c1-11-10(14)12-6-9-13-7-4-2-3-5-8(7)15-9/h2-5H,6H2,1H3,(H2,11,12,14) |
| InChIKey | GXPFAJKUGPUXSM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |