C18H19N3O3S — CID 38167322
1-(1,3-benzothiazol-2-ylmethyl)-3-[(3,4-dimethoxyphenyl)methyl]urea (PubChem CID 38167322) has the molecular formula C18H19N3O3S and a molecular weight of 357.44 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-ylmethyl)-3-[(3,4-dimethoxyphenyl)methyl]urea.
| Compound Name | 1-(1,3-benzothiazol-2-ylmethyl)-3-[(3,4-dimethoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 38167322 |
| Molecular Formula | C18H19N3O3S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 1-(1,3-benzothiazol-2-ylmethyl)-3-[(3,4-dimethoxyphenyl)methyl]urea |
| SMILES | COc1ccc(CNC(=O)NCc2nc3ccccc3s2)cc1OC |
| InChI | InChI=1S/C18H19N3O3S/c1-23-14-8-7-12(9-15(14)24-2)10-19-18(22)20-11-17-21-13-5-3-4-6-16(13)25-17/h3-9H,10-11H2,1-2H3,(H2,19,20,22) |
| InChIKey | ILLFYMXIPNTINO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |