C17H17N3O4S2 — CID 18110845
N-(1,3-benzothiazol-2-ylmethyl)-4-methoxy-3-(methylsulfamoyl)benzamide (PubChem CID 18110845) has the molecular formula C17H17N3O4S2 and a molecular weight of 391.47 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-4-methoxy-3-(methylsulfamoyl)benzamide.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-4-methoxy-3-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 18110845 |
| Molecular Formula | C17H17N3O4S2 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-4-methoxy-3-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1cc(C(=O)NCc2nc3ccccc3s2)ccc1OC |
| InChI | InChI=1S/C17H17N3O4S2/c1-18-26(22,23)15-9-11(7-8-13(15)24-2)17(21)19-10-16-20-12-5-3-4-6-14(12)25-16/h3-9,18H,10H2,1-2H3,(H,19,21) |
| InChIKey | WIZLSAAWNNHJSI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |