C11H13F3N2O4S — CID 18105723
4-methoxy-3-(methylsulfamoyl)-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 18105723) has the molecular formula C11H13F3N2O4S and a molecular weight of 326.30 g/mol. Its IUPAC name is 4-methoxy-3-(methylsulfamoyl)-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-methoxy-3-(methylsulfamoyl)-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 18105723 |
| Molecular Formula | C11H13F3N2O4S |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 4-methoxy-3-(methylsulfamoyl)-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CNS(=O)(=O)c1cc(C(=O)NCC(F)(F)F)ccc1OC |
| InChI | InChI=1S/C11H13F3N2O4S/c1-15-21(18,19)9-5-7(3-4-8(9)20-2)10(17)16-6-11(12,13)14/h3-5,15H,6H2,1-2H3,(H,16,17) |
| InChIKey | IWAPNSCEKIRVHJ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |