C13H15F3N2O4 — CID 51166529
3,4-dimethoxy-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]benzamide (PubChem CID 51166529) has the molecular formula C13H15F3N2O4 and a molecular weight of 320.27 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 51166529 |
| Molecular Formula | C13H15F3N2O4 |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 3,4-dimethoxy-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]benzamide |
| SMILES | COc1ccc(C(=O)NCC(=O)NCC(F)(F)F)cc1OC |
| InChI | InChI=1S/C13H15F3N2O4/c1-21-9-4-3-8(5-10(9)22-2)12(20)17-6-11(19)18-7-13(14,15)16/h3-5H,6-7H2,1-2H3,(H,17,20)(H,18,19) |
| InChIKey | MDONZWGEQDSDBB-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |