C14H18N2O4 — CID 35018344
3,4-dimethoxy-N-[2-oxo-2-(prop-2-enylamino)ethyl]benzamide (PubChem CID 35018344) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[2-oxo-2-(prop-2-enylamino)ethyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[2-oxo-2-(prop-2-enylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 35018344 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 3,4-dimethoxy-N-[2-oxo-2-(prop-2-enylamino)ethyl]benzamide |
| SMILES | C=CCNC(=O)CNC(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C14H18N2O4/c1-4-7-15-13(17)9-16-14(18)10-5-6-11(19-2)12(8-10)20-3/h4-6,8H,1,7,9H2,2-3H3,(H,15,17)(H,16,18) |
| InChIKey | UDMILWQLKSYBFN-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|