C21H22N2O6 — CID 46516482
methyl 2-[[4-[(3-methoxy-4-prop-2-enoxybenzoyl)amino]benzoyl]amino]acetate (PubChem CID 46516482) has the molecular formula C21H22N2O6 and a molecular weight of 398.42 g/mol. Its IUPAC name is methyl 2-[[4-[(3-methoxy-4-prop-2-enoxybenzoyl)amino]benzoyl]amino]acetate.
| Compound Name | methyl 2-[[4-[(3-methoxy-4-prop-2-enoxybenzoyl)amino]benzoyl]amino]acetate |
|---|---|
| PubChem CID | 46516482 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | methyl 2-[[4-[(3-methoxy-4-prop-2-enoxybenzoyl)amino]benzoyl]amino]acetate |
| SMILES | C=CCOc1ccc(C(=O)Nc2ccc(C(=O)NCC(=O)OC)cc2)cc1OC |
| InChI | InChI=1S/C21H22N2O6/c1-4-11-29-17-10-7-15(12-18(17)27-2)21(26)23-16-8-5-14(6-9-16)20(25)22-13-19(24)28-3/h4-10,12H,1,11,13H2,2-3H3,(H,22,25)(H,23,26) |
| InChIKey | ZWHMVLHEZQTIRV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|