C16H21NO5 — CID 119249472
3-[(3-methoxy-4-prop-2-enoxybenzoyl)amino]-2,2-dimethylpropanoic acid (PubChem CID 119249472) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is 3-[(3-methoxy-4-prop-2-enoxybenzoyl)amino]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[(3-methoxy-4-prop-2-enoxybenzoyl)amino]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 119249472 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 3-[(3-methoxy-4-prop-2-enoxybenzoyl)amino]-2,2-dimethylpropanoic acid |
| SMILES | C=CCOc1ccc(C(=O)NCC(C)(C)C(=O)O)cc1OC |
| InChI | InChI=1S/C16H21NO5/c1-5-8-22-12-7-6-11(9-13(12)21-4)14(18)17-10-16(2,3)15(19)20/h5-7,9H,1,8,10H2,2-4H3,(H,17,18)(H,19,20) |
| InChIKey | DIXUYRXMDSLXBH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|