C21H24BrNO5 — CID 24551293
N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-3-methoxy-4-prop-2-enoxybenzamide (PubChem CID 24551293) has the molecular formula C21H24BrNO5 and a molecular weight of 450.33 g/mol. Its IUPAC name is N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-3-methoxy-4-prop-2-enoxybenzamide.
| Compound Name | N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-3-methoxy-4-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 24551293 |
| Molecular Formula | C21H24BrNO5 |
| Molecular Weight | 450.33 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-3-methoxy-4-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccc(C(=O)NCCc2cc(OC)c(OC)cc2Br)cc1OC |
| InChI | InChI=1S/C21H24BrNO5/c1-5-10-28-17-7-6-15(12-18(17)25-2)21(24)23-9-8-14-11-19(26-3)20(27-4)13-16(14)22/h5-7,11-13H,1,8-10H2,2-4H3,(H,23,24) |
| InChIKey | QHVJGBRPYRCLSB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|