C19H21BrN2O5 — CID 24517297
4-(2-amino-2-oxoethoxy)-N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]benzamide (PubChem CID 24517297) has the molecular formula C19H21BrN2O5 and a molecular weight of 437.29 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethoxy)-N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]benzamide.
| Compound Name | 4-(2-amino-2-oxoethoxy)-N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 24517297 |
| Molecular Formula | C19H21BrN2O5 |
| Molecular Weight | 437.29 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | 4-(2-amino-2-oxoethoxy)-N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]benzamide |
| SMILES | COc1cc(Br)c(CCNC(=O)c2ccc(OCC(N)=O)cc2)cc1OC |
| InChI | InChI=1S/C19H21BrN2O5/c1-25-16-9-13(15(20)10-17(16)26-2)7-8-22-19(24)12-3-5-14(6-4-12)27-11-18(21)23/h3-6,9-10H,7-8,11H2,1-2H3,(H2,21,23)(H,22,24) |
| InChIKey | JZFZAUIMQFIANK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |