C19H23BrN2O4S — CID 32623799
N-[4-[2-(2-bromo-4,5-dimethoxyphenyl)ethylamino]-4-oxobutyl]thiophene-3-carboxamide (PubChem CID 32623799) has the molecular formula C19H23BrN2O4S and a molecular weight of 455.37 g/mol. Its IUPAC name is N-[4-[2-(2-bromo-4,5-dimethoxyphenyl)ethylamino]-4-oxobutyl]thiophene-3-carboxamide.
| Compound Name | N-[4-[2-(2-bromo-4,5-dimethoxyphenyl)ethylamino]-4-oxobutyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 32623799 |
| Molecular Formula | C19H23BrN2O4S |
| Molecular Weight | 455.37 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | N-[4-[2-(2-bromo-4,5-dimethoxyphenyl)ethylamino]-4-oxobutyl]thiophene-3-carboxamide |
| SMILES | COc1cc(Br)c(CCNC(=O)CCCNC(=O)c2ccsc2)cc1OC |
| InChI | InChI=1S/C19H23BrN2O4S/c1-25-16-10-13(15(20)11-17(16)26-2)5-8-21-18(23)4-3-7-22-19(24)14-6-9-27-12-14/h6,9-12H,3-5,7-8H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | PJBHKGPNXKSXIL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|