C15H19N3O2S2 — CID 38162912
N-[4-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]-4-oxobutyl]thiophene-3-carboxamide (PubChem CID 38162912) has the molecular formula C15H19N3O2S2 and a molecular weight of 337.47 g/mol. Its IUPAC name is N-[4-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]-4-oxobutyl]thiophene-3-carboxamide.
| Compound Name | N-[4-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]-4-oxobutyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 38162912 |
| Molecular Formula | C15H19N3O2S2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | N-[4-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]-4-oxobutyl]thiophene-3-carboxamide |
| SMILES | Cc1nc(CCNC(=O)CCCNC(=O)c2ccsc2)cs1 |
| InChI | InChI=1S/C15H19N3O2S2/c1-11-18-13(10-22-11)4-7-16-14(19)3-2-6-17-15(20)12-5-8-21-9-12/h5,8-10H,2-4,6-7H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | GLXWIHXALWMVRP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|