C8H12N2OS — CID 77059141
N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]acetamide (PubChem CID 77059141) has the molecular formula C8H12N2OS and a molecular weight of 184.26 g/mol. Its IUPAC name is N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]acetamide.
| Compound Name | N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 77059141 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]acetamide |
| SMILES | CC(=O)NCCc1csc(C)n1 |
| InChI | InChI=1S/C8H12N2OS/c1-6(11)9-4-3-8-5-12-7(2)10-8/h5H,3-4H2,1-2H3,(H,9,11) |
| InChIKey | JENQDIVOSWSWIK-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |