C11H17BrN2OS — CID 106033629
5-bromo-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]pentanamide (PubChem CID 106033629) has the molecular formula C11H17BrN2OS and a molecular weight of 305.24 g/mol. Its IUPAC name is 5-bromo-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]pentanamide.
| Compound Name | 5-bromo-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]pentanamide |
|---|---|
| PubChem CID | 106033629 |
| Molecular Formula | C11H17BrN2OS |
| Molecular Weight | 305.24 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 5-bromo-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]pentanamide |
| SMILES | Cc1nc(CCNC(=O)CCCCBr)cs1 |
| InChI | InChI=1S/C11H17BrN2OS/c1-9-14-10(8-16-9)5-7-13-11(15)4-2-3-6-12/h8H,2-7H2,1H3,(H,13,15) |
| InChIKey | LRQXQACSJQYDDV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.24 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|