C16H28N4O2S — CID 111932078
methyl 7-[[N'-methyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]carbamimidoyl]amino]heptanoate (PubChem CID 111932078) has the molecular formula C16H28N4O2S and a molecular weight of 340.49 g/mol. Its IUPAC name is methyl 7-[[N'-methyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]carbamimidoyl]amino]heptanoate.
| Compound Name | methyl 7-[[N'-methyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]carbamimidoyl]amino]heptanoate |
|---|---|
| PubChem CID | 111932078 |
| Molecular Formula | C16H28N4O2S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | methyl 7-[[N'-methyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]carbamimidoyl]amino]heptanoate |
| SMILES | C/N=C(\NCCCCCCC(=O)OC)NCCc1csc(C)n1 |
| InChI | InChI=1S/C16H28N4O2S/c1-13-20-14(12-23-13)9-11-19-16(17-2)18-10-7-5-4-6-8-15(21)22-3/h12H,4-11H2,1-3H3,(H2,17,18,19) |
| InChIKey | ZQYLJBVZFPWCRY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|