C13H25N5O2S2 — CID 111932790
1-[3-(ethylsulfonylamino)propyl]-2-methyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine (PubChem CID 111932790) has the molecular formula C13H25N5O2S2 and a molecular weight of 347.51 g/mol. Its IUPAC name is 1-[3-(ethylsulfonylamino)propyl]-2-methyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine.
| Compound Name | 1-[3-(ethylsulfonylamino)propyl]-2-methyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111932790 |
| Molecular Formula | C13H25N5O2S2 |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 1-[3-(ethylsulfonylamino)propyl]-2-methyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine |
| SMILES | CCS(=O)(=O)NCCCN/C(=N\C)NCCc1csc(C)n1 |
| InChI | InChI=1S/C13H25N5O2S2/c1-4-22(19,20)17-8-5-7-15-13(14-3)16-9-6-12-10-21-11(2)18-12/h10,17H,4-9H2,1-3H3,(H2,14,15,16) |
| InChIKey | DEFFMOPZZFEEMT-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|