C17H20N2O2S — CID 51191802
N-[4-(2,6-dimethylanilino)-4-oxobutyl]thiophene-3-carboxamide (PubChem CID 51191802) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is N-[4-(2,6-dimethylanilino)-4-oxobutyl]thiophene-3-carboxamide.
| Compound Name | N-[4-(2,6-dimethylanilino)-4-oxobutyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 51191802 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | N-[4-(2,6-dimethylanilino)-4-oxobutyl]thiophene-3-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)CCCNC(=O)c1ccsc1 |
| InChI | InChI=1S/C17H20N2O2S/c1-12-5-3-6-13(2)16(12)19-15(20)7-4-9-18-17(21)14-8-10-22-11-14/h3,5-6,8,10-11H,4,7,9H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | NAZMGOSDZNJDHT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|