C14H12F2N2O2S — CID 78802763
N-[3-(2,6-difluoroanilino)-3-oxopropyl]thiophene-3-carboxamide (PubChem CID 78802763) has the molecular formula C14H12F2N2O2S and a molecular weight of 310.32 g/mol. Its IUPAC name is N-[3-(2,6-difluoroanilino)-3-oxopropyl]thiophene-3-carboxamide.
| Compound Name | N-[3-(2,6-difluoroanilino)-3-oxopropyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 78802763 |
| Molecular Formula | C14H12F2N2O2S |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | N-[3-(2,6-difluoroanilino)-3-oxopropyl]thiophene-3-carboxamide |
| SMILES | O=C(CCNC(=O)c1ccsc1)Nc1c(F)cccc1F |
| InChI | InChI=1S/C14H12F2N2O2S/c15-10-2-1-3-11(16)13(10)18-12(19)4-6-17-14(20)9-5-7-21-8-9/h1-3,5,7-8H,4,6H2,(H,17,20)(H,18,19) |
| InChIKey | ACOKIBIWWHEXTO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |