C14H12Br2N2O2S — CID 39166512
N-[3-(2,5-dibromoanilino)-3-oxopropyl]thiophene-3-carboxamide (PubChem CID 39166512) has the molecular formula C14H12Br2N2O2S and a molecular weight of 432.14 g/mol. Its IUPAC name is N-[3-(2,5-dibromoanilino)-3-oxopropyl]thiophene-3-carboxamide.
| Compound Name | N-[3-(2,5-dibromoanilino)-3-oxopropyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 39166512 |
| Molecular Formula | C14H12Br2N2O2S |
| Molecular Weight | 432.14 g/mol |
| Exact Mass | 429.90 |
| IUPAC Name | N-[3-(2,5-dibromoanilino)-3-oxopropyl]thiophene-3-carboxamide |
| SMILES | O=C(CCNC(=O)c1ccsc1)Nc1cc(Br)ccc1Br |
| InChI | InChI=1S/C14H12Br2N2O2S/c15-10-1-2-11(16)12(7-10)18-13(19)3-5-17-14(20)9-4-6-21-8-9/h1-2,4,6-8H,3,5H2,(H,17,20)(H,18,19) |
| InChIKey | BIJDBCXURSPSQH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.14 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |