C14H15N3O2S — CID 18106915
N-[3-[(4-methyl-2-pyridinyl)amino]-3-oxopropyl]thiophene-3-carboxamide (PubChem CID 18106915) has the molecular formula C14H15N3O2S and a molecular weight of 289.36 g/mol. Its IUPAC name is N-[3-[(4-methyl-2-pyridinyl)amino]-3-oxopropyl]thiophene-3-carboxamide.
| Compound Name | N-[3-[(4-methyl-2-pyridinyl)amino]-3-oxopropyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 18106915 |
| Molecular Formula | C14H15N3O2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-[3-[(4-methyl-2-pyridinyl)amino]-3-oxopropyl]thiophene-3-carboxamide |
| SMILES | Cc1ccnc(NC(=O)CCNC(=O)c2ccsc2)c1 |
| InChI | InChI=1S/C14H15N3O2S/c1-10-2-5-15-12(8-10)17-13(18)3-6-16-14(19)11-4-7-20-9-11/h2,4-5,7-9H,3,6H2,1H3,(H,16,19)(H,15,17,18) |
| InChIKey | UVINCYDAQXPENF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |