C18H20N6OS — CID 122315488
N-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]thiophene-3-carboxamide (PubChem CID 122315488) has the molecular formula C18H20N6OS and a molecular weight of 368.47 g/mol. Its IUPAC name is N-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]thiophene-3-carboxamide.
| Compound Name | N-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 122315488 |
| Molecular Formula | C18H20N6OS |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | N-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]thiophene-3-carboxamide |
| SMILES | Cc1ccnc(Nc2cc(NCCNC(=O)c3ccsc3)nc(C)n2)c1 |
| InChI | InChI=1S/C18H20N6OS/c1-12-3-5-19-15(9-12)24-17-10-16(22-13(2)23-17)20-6-7-21-18(25)14-4-8-26-11-14/h3-5,8-11H,6-7H2,1-2H3,(H,21,25)(H2,19,20,22,23,24) |
| InChIKey | ZOEFHVKXIQOEKP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|