C17H18N6O2 — CID 122314731
N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]furan-3-carboxamide (PubChem CID 122314731) has the molecular formula C17H18N6O2 and a molecular weight of 338.37 g/mol. Its IUPAC name is N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]furan-3-carboxamide.
| Compound Name | N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 122314731 |
| Molecular Formula | C17H18N6O2 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]furan-3-carboxamide |
| SMILES | Cc1ccnc(Nc2cc(NCCNC(=O)c3ccoc3)ncn2)c1 |
| InChI | InChI=1S/C17H18N6O2/c1-12-2-4-18-15(8-12)23-16-9-14(21-11-22-16)19-5-6-20-17(24)13-3-7-25-10-13/h2-4,7-11H,5-6H2,1H3,(H,20,24)(H2,18,19,21,22,23) |
| InChIKey | HAIHFRWAFZGCOC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|