C19H21N7O2 — CID 122314725
5-cyclopropyl-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]-1,2-oxazole-3-carboxamide (PubChem CID 122314725) has the molecular formula C19H21N7O2 and a molecular weight of 379.42 g/mol. Its IUPAC name is 5-cyclopropyl-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-cyclopropyl-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 122314725 |
| Molecular Formula | C19H21N7O2 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 5-cyclopropyl-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]-1,2-oxazole-3-carboxamide |
| SMILES | Cc1ccnc(Nc2cc(NCCNC(=O)c3cc(C4CC4)on3)ncn2)c1 |
| InChI | InChI=1S/C19H21N7O2/c1-12-4-5-20-17(8-12)25-18-10-16(23-11-24-18)21-6-7-22-19(27)14-9-15(28-26-14)13-2-3-13/h4-5,8-11,13H,2-3,6-7H2,1H3,(H,22,27)(H2,20,21,23,24,25) |
| InChIKey | PBPHSUIOIAOYRU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|