C17H21N9O — CID 122315557
1-methyl-N-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]triazole-4-carboxamide (PubChem CID 122315557) has the molecular formula C17H21N9O and a molecular weight of 367.42 g/mol. Its IUPAC name is 1-methyl-N-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]triazole-4-carboxamide.
| Compound Name | 1-methyl-N-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 122315557 |
| Molecular Formula | C17H21N9O |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 1-methyl-N-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]triazole-4-carboxamide |
| SMILES | Cc1ccnc(Nc2cc(NCCNC(=O)c3cn(C)nn3)nc(C)n2)c1 |
| InChI | InChI=1S/C17H21N9O/c1-11-4-5-18-14(8-11)23-16-9-15(21-12(2)22-16)19-6-7-20-17(27)13-10-26(3)25-24-13/h4-5,8-10H,6-7H2,1-3H3,(H,20,27)(H2,18,19,21,22,23) |
| InChIKey | WQAVJYVMAUNMLP-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 122.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|