C21H22F2N6OS — CID 122315569
2-(difluoromethylsulfanyl)-N-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]benzamide (PubChem CID 122315569) has the molecular formula C21H22F2N6OS and a molecular weight of 444.51 g/mol. Its IUPAC name is 2-(difluoromethylsulfanyl)-N-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]benzamide.
| Compound Name | 2-(difluoromethylsulfanyl)-N-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 122315569 |
| Molecular Formula | C21H22F2N6OS |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 2-(difluoromethylsulfanyl)-N-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]benzamide |
| SMILES | Cc1ccnc(Nc2cc(NCCNC(=O)c3ccccc3SC(F)F)nc(C)n2)c1 |
| InChI | InChI=1S/C21H22F2N6OS/c1-13-7-8-24-17(11-13)29-19-12-18(27-14(2)28-19)25-9-10-26-20(30)15-5-3-4-6-16(15)31-21(22)23/h3-8,11-12,21H,9-10H2,1-2H3,(H,26,30)(H2,24,25,27,28,29) |
| InChIKey | BEDFYZRJPPQCFZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|