C20H20Cl2N6O — CID 122315358
2,4-dichloro-N-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]benzamide (PubChem CID 122315358) has the molecular formula C20H20Cl2N6O and a molecular weight of 431.33 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 122315358 |
| Molecular Formula | C20H20Cl2N6O |
| Molecular Weight | 431.33 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 2,4-dichloro-N-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]benzamide |
| SMILES | Cc1ccnc(Nc2cc(NCCNC(=O)c3ccc(Cl)cc3Cl)nc(C)n2)c1 |
| InChI | InChI=1S/C20H20Cl2N6O/c1-12-5-6-23-17(9-12)28-19-11-18(26-13(2)27-19)24-7-8-25-20(29)15-4-3-14(21)10-16(15)22/h3-6,9-11H,7-8H2,1-2H3,(H,25,29)(H2,23,24,26,27,28) |
| InChIKey | PFKGNHWVLLKNCW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.33 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|