C19H18F2N6O — CID 122314561
2,4-difluoro-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]benzamide (PubChem CID 122314561) has the molecular formula C19H18F2N6O and a molecular weight of 384.39 g/mol. Its IUPAC name is 2,4-difluoro-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]benzamide.
| Compound Name | 2,4-difluoro-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 122314561 |
| Molecular Formula | C19H18F2N6O |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 2,4-difluoro-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]benzamide |
| SMILES | Cc1ccnc(Nc2cc(NCCNC(=O)c3ccc(F)cc3F)ncn2)c1 |
| InChI | InChI=1S/C19H18F2N6O/c1-12-4-5-22-17(8-12)27-18-10-16(25-11-26-18)23-6-7-24-19(28)14-3-2-13(20)9-15(14)21/h2-5,8-11H,6-7H2,1H3,(H,24,28)(H2,22,23,25,26,27) |
| InChIKey | ZZBQQAUYRRRCRF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|