C19H21FN6O2S — CID 122314859
1-(2-fluorophenyl)-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]methanesulfonamide (PubChem CID 122314859) has the molecular formula C19H21FN6O2S and a molecular weight of 416.48 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]methanesulfonamide.
| Compound Name | 1-(2-fluorophenyl)-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 122314859 |
| Molecular Formula | C19H21FN6O2S |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 1-(2-fluorophenyl)-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]methanesulfonamide |
| SMILES | Cc1ccnc(Nc2cc(NCCNS(=O)(=O)Cc3ccccc3F)ncn2)c1 |
| InChI | InChI=1S/C19H21FN6O2S/c1-14-6-7-21-18(10-14)26-19-11-17(23-13-24-19)22-8-9-25-29(27,28)12-15-4-2-3-5-16(15)20/h2-7,10-11,13,25H,8-9,12H2,1H3,(H2,21,22,23,24,26) |
| InChIKey | IIDSLJLWRQWFEU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 108.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|