C19H19FN10O2S — CID 122314879
4-fluoro-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]-3-(2H-tetrazol-5-yl)benzenesulfonamide (PubChem CID 122314879) has the molecular formula C19H19FN10O2S and a molecular weight of 470.49 g/mol. Its IUPAC name is 4-fluoro-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]-3-(2H-tetrazol-5-yl)benzenesulfonamide.
| Compound Name | 4-fluoro-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]-3-(2H-tetrazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 122314879 |
| Molecular Formula | C19H19FN10O2S |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 4-fluoro-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]-3-(2H-tetrazol-5-yl)benzenesulfonamide |
| SMILES | Cc1ccnc(Nc2cc(NCCNS(=O)(=O)c3ccc(F)c(-c4nn[nH]n4)c3)ncn2)c1 |
| InChI | InChI=1S/C19H19FN10O2S/c1-12-4-5-21-17(8-12)26-18-10-16(23-11-24-18)22-6-7-25-33(31,32)13-2-3-15(20)14(9-13)19-27-29-30-28-19/h2-5,8-11,25H,6-7H2,1H3,(H,27,28,29,30)(H2,21,22,23,24,26) |
| InChIKey | ARNYMGDEXYZIBN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 163.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|