C16H20FN9O2S — CID 122293530
N-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-4-fluoro-3-(2H-tetrazol-5-yl)benzenesulfonamide (PubChem CID 122293530) has the molecular formula C16H20FN9O2S and a molecular weight of 421.46 g/mol. Its IUPAC name is N-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-4-fluoro-3-(2H-tetrazol-5-yl)benzenesulfonamide.
| Compound Name | N-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-4-fluoro-3-(2H-tetrazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 122293530 |
| Molecular Formula | C16H20FN9O2S |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | N-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-4-fluoro-3-(2H-tetrazol-5-yl)benzenesulfonamide |
| SMILES | CCNc1cc(NCCNS(=O)(=O)c2ccc(F)c(-c3nn[nH]n3)c2)nc(C)n1 |
| InChI | InChI=1S/C16H20FN9O2S/c1-3-18-14-9-15(22-10(2)21-14)19-6-7-20-29(27,28)11-4-5-13(17)12(8-11)16-23-25-26-24-16/h4-5,8-9,20H,3,6-7H2,1-2H3,(H2,18,19,21,22)(H,23,24,25,26) |
| InChIKey | BPZQOHFYCHAXSG-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 150.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|