C15H20FN5O2S — CID 121074810
N-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-3-fluorobenzenesulfonamide (PubChem CID 121074810) has the molecular formula C15H20FN5O2S and a molecular weight of 353.42 g/mol. Its IUPAC name is N-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-3-fluorobenzenesulfonamide.
| Compound Name | N-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 121074810 |
| Molecular Formula | C15H20FN5O2S |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | N-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-3-fluorobenzenesulfonamide |
| SMILES | CCNc1cc(NCCNS(=O)(=O)c2cccc(F)c2)nc(C)n1 |
| InChI | InChI=1S/C15H20FN5O2S/c1-3-17-14-10-15(21-11(2)20-14)18-7-8-19-24(22,23)13-6-4-5-12(16)9-13/h4-6,9-10,19H,3,7-8H2,1-2H3,(H2,17,18,20,21) |
| InChIKey | ZIGBWPSQCBJBAD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|