C18H19FN6O2S — CID 70702646
3-fluoro-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]benzenesulfonamide (PubChem CID 70702646) has the molecular formula C18H19FN6O2S and a molecular weight of 402.46 g/mol. Its IUPAC name is 3-fluoro-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 3-fluoro-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 70702646 |
| Molecular Formula | C18H19FN6O2S |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 3-fluoro-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]benzenesulfonamide |
| SMILES | Cc1ccc(Nc2ccc(NCCNS(=O)(=O)c3cccc(F)c3)nn2)nc1 |
| InChI | InChI=1S/C18H19FN6O2S/c1-13-5-6-16(21-12-13)23-18-8-7-17(24-25-18)20-9-10-22-28(26,27)15-4-2-3-14(19)11-15/h2-8,11-12,22H,9-10H2,1H3,(H,20,24)(H,21,23,25) |
| InChIKey | JDOZICKKRALOCN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 108.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|