C18H18Cl2N6O2S — CID 122326772
2,5-dichloro-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]benzenesulfonamide (PubChem CID 122326772) has the molecular formula C18H18Cl2N6O2S and a molecular weight of 453.36 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122326772 |
| Molecular Formula | C18H18Cl2N6O2S |
| Molecular Weight | 453.36 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 2,5-dichloro-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]benzenesulfonamide |
| SMILES | Cc1ccc(Nc2ccc(NCCNS(=O)(=O)c3cc(Cl)ccc3Cl)nn2)nc1 |
| InChI | InChI=1S/C18H18Cl2N6O2S/c1-12-2-5-16(22-11-12)24-18-7-6-17(25-26-18)21-8-9-23-29(27,28)15-10-13(19)3-4-14(15)20/h2-7,10-11,23H,8-9H2,1H3,(H,21,25)(H,22,24,26) |
| InChIKey | RNDHVLIUECMAFI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 108.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|