C18H19ClN6O2S — CID 122289230
5-chloro-2-methyl-N-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]benzenesulfonamide (PubChem CID 122289230) has the molecular formula C18H19ClN6O2S and a molecular weight of 418.91 g/mol. Its IUPAC name is 5-chloro-2-methyl-N-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 5-chloro-2-methyl-N-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122289230 |
| Molecular Formula | C18H19ClN6O2S |
| Molecular Weight | 418.91 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 5-chloro-2-methyl-N-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]benzenesulfonamide |
| SMILES | Cc1ccc(Cl)cc1S(=O)(=O)NCCNc1ccc(Nc2ccncc2)nn1 |
| InChI | InChI=1S/C18H19ClN6O2S/c1-13-2-3-14(19)12-16(13)28(26,27)22-11-10-21-17-4-5-18(25-24-17)23-15-6-8-20-9-7-15/h2-9,12,22H,10-11H2,1H3,(H,21,24)(H,20,23,25) |
| InChIKey | JNHBOFFYSLCEGQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 108.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.91 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|