C19H21BrN6O3S — CID 121065174
5-bromo-2-ethoxy-N-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]benzenesulfonamide (PubChem CID 121065174) has the molecular formula C19H21BrN6O3S and a molecular weight of 493.39 g/mol. Its IUPAC name is 5-bromo-2-ethoxy-N-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 5-bromo-2-ethoxy-N-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 121065174 |
| Molecular Formula | C19H21BrN6O3S |
| Molecular Weight | 493.39 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | 5-bromo-2-ethoxy-N-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]benzenesulfonamide |
| SMILES | CCOc1ccc(Br)cc1S(=O)(=O)NCCNc1ccc(Nc2ccncc2)nn1 |
| InChI | InChI=1S/C19H21BrN6O3S/c1-2-29-16-4-3-14(20)13-17(16)30(27,28)23-12-11-22-18-5-6-19(26-25-18)24-15-7-9-21-10-8-15/h3-10,13,23H,2,11-12H2,1H3,(H,22,25)(H,21,24,26) |
| InChIKey | XVCFKSUMHYWXKG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 118.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|