C20H28BrN5O3S — CID 122326681
5-bromo-2-ethoxy-N-[2-[(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide (PubChem CID 122326681) has the molecular formula C20H28BrN5O3S and a molecular weight of 498.45 g/mol. Its IUPAC name is 5-bromo-2-ethoxy-N-[2-[(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide.
| Compound Name | 5-bromo-2-ethoxy-N-[2-[(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122326681 |
| Molecular Formula | C20H28BrN5O3S |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | 5-bromo-2-ethoxy-N-[2-[(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide |
| SMILES | CCOc1ccc(Br)cc1S(=O)(=O)NCCNc1cc(N2CCCCC2)nc(C)n1 |
| InChI | InChI=1S/C20H28BrN5O3S/c1-3-29-17-8-7-16(21)13-18(17)30(27,28)23-10-9-22-19-14-20(25-15(2)24-19)26-11-5-4-6-12-26/h7-8,13-14,23H,3-6,9-12H2,1-2H3,(H,22,24,25) |
| InChIKey | SBYMIBFUAKBLHK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|