C23H27N5O3S — CID 121074870
N-[2-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]-4-phenoxybenzenesulfonamide (PubChem CID 121074870) has the molecular formula C23H27N5O3S and a molecular weight of 453.57 g/mol. Its IUPAC name is N-[2-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]-4-phenoxybenzenesulfonamide.
| Compound Name | N-[2-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]-4-phenoxybenzenesulfonamide |
|---|---|
| PubChem CID | 121074870 |
| Molecular Formula | C23H27N5O3S |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | N-[2-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]-4-phenoxybenzenesulfonamide |
| SMILES | Cc1nc(NCCNS(=O)(=O)c2ccc(Oc3ccccc3)cc2)cc(N2CCCC2)n1 |
| InChI | InChI=1S/C23H27N5O3S/c1-18-26-22(17-23(27-18)28-15-5-6-16-28)24-13-14-25-32(29,30)21-11-9-20(10-12-21)31-19-7-3-2-4-8-19/h2-4,7-12,17,25H,5-6,13-16H2,1H3,(H,24,26,27) |
| InChIKey | SODRXKDORDHBMW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|